6-nitrohexanoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

6-nitrohexanoic acid
CAS RN:[10269-96-2]
Formula:C6H11NO4; 161.16 g/mol
InChiKey:RDMHCTBEKVBKLF-UHFFFAOYSA-N
SMILES:OC(=O)CCCCC[N+]([O-])=O
Molecular structure of 6-nitrohexanoic acid
Density:1.186 g/mL
Molar volume:135.9 mL/mol
Melting point:22 °C

Isomers

2-aminoadipic acid
Molecular structure of 2-aminoadipic acid
L-2-aminoadipic acid
Molecular structure of L-2-aminoadipic acid
(2R)-2-aminohexanedioic acid
Molecular structure of (2R)-2-aminohexanedioic acid
3-(2-carboxyethylamino)propanoic acid
Molecular structure of 3-(2-carboxyethylamino)propanoic acid
2-[carboxymethyl(ethyl)amino]acetic acid
Molecular structure of 2-[carboxymethyl(ethyl)amino]acetic acid
2-[(2-ethoxy-2-oxoethyl)amino]acetic acid
Molecular structure of 2-[(2-ethoxy-2-oxoethyl)amino]acetic acid
DL-2-methylglutamic acid hemihydrate
Molecular structure of DL-2-methylglutamic acid hemihydrate
6-nitrohexanoic acid
Molecular structure of 6-nitrohexanoic acid
  ::